C17H18BrNO — CID 43762666
2-bromo-N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]aniline (PubChem CID 43762666) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-bromo-N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]aniline.
| Compound Name | 2-bromo-N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]aniline |
|---|---|
| PubChem CID | 43762666 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-bromo-N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]aniline |
| SMILES | CCC(Nc1ccccc1Br)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H18BrNO/c1-2-15(19-16-6-4-3-5-14(16)18)12-7-8-17-13(11-12)9-10-20-17/h3-8,11,15,19H,2,9-10H2,1H3 |
| InChIKey | YSTCYXILRISMRF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |