C17H17FINO — CID 79759306
N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-fluoro-2-iodoaniline (PubChem CID 79759306) has the molecular formula C17H17FINO and a molecular weight of 397.23 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-fluoro-2-iodoaniline.
| Compound Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 79759306 |
| Molecular Formula | C17H17FINO |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-fluoro-2-iodoaniline |
| SMILES | CCC(Nc1ccc(F)cc1I)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H17FINO/c1-2-15(20-16-5-4-13(18)10-14(16)19)11-3-6-17-12(9-11)7-8-21-17/h3-6,9-10,15,20H,2,7-8H2,1H3 |
| InChIKey | FWGQNGUIVRMDBF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|