C18H20INO — CID 43785264
N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-iodo-2-methylaniline (PubChem CID 43785264) has the molecular formula C18H20INO and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-iodo-2-methylaniline.
| Compound Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 43785264 |
| Molecular Formula | C18H20INO |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)propyl]-4-iodo-2-methylaniline |
| SMILES | CCC(Nc1ccc(I)cc1C)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H20INO/c1-3-16(20-17-6-5-15(19)10-12(17)2)13-4-7-18-14(11-13)8-9-21-18/h4-7,10-11,16,20H,3,8-9H2,1-2H3 |
| InChIKey | IHBNSBRIDKAHRU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|