C14H24N2O2S2 — CID 43778771
1-methylsulfonyl-N-(2-methyl-1-thiophen-2-ylpropyl)piperidin-4-amine (PubChem CID 43778771) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(2-methyl-1-thiophen-2-ylpropyl)piperidin-4-amine.
| Compound Name | 1-methylsulfonyl-N-(2-methyl-1-thiophen-2-ylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 43778771 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-methylsulfonyl-N-(2-methyl-1-thiophen-2-ylpropyl)piperidin-4-amine |
| SMILES | CC(C)C(NC1CCN(S(C)(=O)=O)CC1)c1cccs1 |
| InChI | InChI=1S/C14H24N2O2S2/c1-11(2)14(13-5-4-10-19-13)15-12-6-8-16(9-7-12)20(3,17)18/h4-5,10-12,14-15H,6-9H2,1-3H3 |
| InChIKey | LTHUOZNQVFZLRW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |