C14H14BrF2NOS — CID 43787832
5-bromo-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-methylaniline (PubChem CID 43787832) has the molecular formula C14H14BrF2NOS and a molecular weight of 362.24 g/mol. Its IUPAC name is 5-bromo-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-methylaniline.
| Compound Name | 5-bromo-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 43787832 |
| Molecular Formula | C14H14BrF2NOS |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 5-bromo-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-methylaniline |
| SMILES | Cc1ccc(Br)cc1NCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C14H14BrF2NOS/c1-9-2-3-10(15)6-13(9)18-7-11-4-5-12(19-11)8-20-14(16)17/h2-6,14,18H,7-8H2,1H3 |
| InChIKey | LUQJJPWVVYDXLK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |