C16H20BrN — CID 43787868
N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-5-bromo-2-methylaniline (PubChem CID 43787868) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-5-bromo-2-methylaniline.
| Compound Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-5-bromo-2-methylaniline |
|---|---|
| PubChem CID | 43787868 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-5-bromo-2-methylaniline |
| SMILES | Cc1ccc(Br)cc1NC(C)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H20BrN/c1-10-3-6-14(17)9-16(10)18-11(2)15-8-12-4-5-13(15)7-12/h3-6,9,11-13,15,18H,7-8H2,1-2H3 |
| InChIKey | ZCPBJPMVSSTZJN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|