C16H15Br2NO2 — CID 43788545
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 43788545) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 43788545 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | COc1c(Br)cc(Br)cc1CNc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H15Br2NO2/c1-20-16-11(6-12(17)8-14(16)18)9-19-13-2-3-15-10(7-13)4-5-21-15/h2-3,6-8,19H,4-5,9H2,1H3 |
| InChIKey | FFGYBJLPEQMUBN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|