C16H15Br2NO2 — CID 43789312
N-(2,5-dibromophenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43789312) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-(2,5-dibromophenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43789312 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | N-(2,5-dibromophenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)C(Nc1cc(Br)ccc1Br)CCO2 |
| InChI | InChI=1S/C16H15Br2NO2/c1-20-11-3-5-16-12(9-11)14(6-7-21-16)19-15-8-10(17)2-4-13(15)18/h2-5,8-9,14,19H,6-7H2,1H3 |
| InChIKey | AYNDMZQKBZOLBY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |