C15H21BrN4S — CID 43791295
1-(3-bromothiophen-2-yl)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine (PubChem CID 43791295) has the molecular formula C15H21BrN4S and a molecular weight of 369.33 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43791295 |
| Molecular Formula | C15H21BrN4S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine |
| SMILES | CC(NC(C)c1nnc2n1CCCCC2)c1sccc1Br |
| InChI | InChI=1S/C15H21BrN4S/c1-10(14-12(16)7-9-21-14)17-11(2)15-19-18-13-6-4-3-5-8-20(13)15/h7,9-11,17H,3-6,8H2,1-2H3 |
| InChIKey | DZPJCYKJKXOXQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |