C15H22FNO2 — CID 43795412
1-(5-fluoro-2-methoxyphenyl)-2-[propan-2-yl(propyl)amino]ethanone (PubChem CID 43795412) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-2-[propan-2-yl(propyl)amino]ethanone.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-2-[propan-2-yl(propyl)amino]ethanone |
|---|---|
| PubChem CID | 43795412 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-2-[propan-2-yl(propyl)amino]ethanone |
| SMILES | CCCN(CC(=O)c1cc(F)ccc1OC)C(C)C |
| InChI | InChI=1S/C15H22FNO2/c1-5-8-17(11(2)3)10-14(18)13-9-12(16)6-7-15(13)19-4/h6-7,9,11H,5,8,10H2,1-4H3 |
| InChIKey | BSHRFNIOPWNDJL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |