C12H15FO4S — CID 64641649
1-(5-fluoro-2-methoxyphenyl)-2-propylsulfonylethanone (PubChem CID 64641649) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-2-propylsulfonylethanone.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-2-propylsulfonylethanone |
|---|---|
| PubChem CID | 64641649 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-2-propylsulfonylethanone |
| SMILES | CCCS(=O)(=O)CC(=O)c1cc(F)ccc1OC |
| InChI | InChI=1S/C12H15FO4S/c1-3-6-18(15,16)8-11(14)10-7-9(13)4-5-12(10)17-2/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | BXGMGIPGDWUSTI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |