C13H18FNO3 — CID 62052022
2-[ethyl(2-hydroxyethyl)amino]-1-(5-fluoro-2-methoxyphenyl)ethanone (PubChem CID 62052022) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]-1-(5-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]-1-(5-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 62052022 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]-1-(5-fluoro-2-methoxyphenyl)ethanone |
| SMILES | CCN(CCO)CC(=O)c1cc(F)ccc1OC |
| InChI | InChI=1S/C13H18FNO3/c1-3-15(6-7-16)9-12(17)11-8-10(14)4-5-13(11)18-2/h4-5,8,16H,3,6-7,9H2,1-2H3 |
| InChIKey | FHDVABQEHXILJI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |