C19H27FN6O2 — CID 43811842
ethyl 2-[5-[1-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropyl]tetrazol-1-yl]acetate (PubChem CID 43811842) has the molecular formula C19H27FN6O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 2-[5-[1-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropyl]tetrazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[1-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropyl]tetrazol-1-yl]acetate |
|---|---|
| PubChem CID | 43811842 |
| Molecular Formula | C19H27FN6O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | ethyl 2-[5-[1-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropyl]tetrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nnnc1C(C(C)C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN6O2/c1-4-28-17(27)13-26-19(21-22-23-26)18(14(2)3)25-11-9-24(10-12-25)16-8-6-5-7-15(16)20/h5-8,14,18H,4,9-13H2,1-3H3 |
| InChIKey | ULJPRHVJYJVJLD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |