C30H26ClN5O4S — CID 43819667
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-(2,3-dioxoindol-1-yl)acetamide (PubChem CID 43819667) has the molecular formula C30H26ClN5O4S and a molecular weight of 588.09 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-(2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-(2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 43819667 |
| Molecular Formula | C30H26ClN5O4S |
| Molecular Weight | 588.09 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-(2,3-dioxoindol-1-yl)acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CN(Cc2nc(-c3ccc(Cl)cc3)cs2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H26ClN5O4S/c1-34(2)22-13-11-21(12-14-22)32-26(37)15-35(16-27-33-24(18-41-27)19-7-9-20(31)10-8-19)28(38)17-36-25-6-4-3-5-23(25)29(39)30(36)40/h3-14,18H,15-17H2,1-2H3,(H,32,37) |
| InChIKey | IZRIJFBWUGQOMX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.09 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|