C11H21N3O2S2 — CID 43828130
3-(6-aminohexyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione (PubChem CID 43828130) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-(6-aminohexyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione.
| Compound Name | 3-(6-aminohexyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 43828130 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-(6-aminohexyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione |
| SMILES | NCCCCCCN1C(=S)NC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C11H21N3O2S2/c12-5-3-1-2-4-6-14-10-8-18(15,16)7-9(10)13-11(14)17/h9-10H,1-8,12H2,(H,13,17) |
| InChIKey | JMHBJMNETSHSIF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|