C6H10N2O4S3 — CID 16641896
4-methyl-1,1,6,6-tetraoxo-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazine-3-thione (PubChem CID 16641896) has the molecular formula C6H10N2O4S3 and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-methyl-1,1,6,6-tetraoxo-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazine-3-thione.
| Compound Name | 4-methyl-1,1,6,6-tetraoxo-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazine-3-thione |
|---|---|
| PubChem CID | 16641896 |
| Molecular Formula | C6H10N2O4S3 |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 4-methyl-1,1,6,6-tetraoxo-4a,5,7,7a-tetrahydrothieno[3,4-e][1,2,4]thiadiazine-3-thione |
| SMILES | CN1C(=S)NS(=O)(=O)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C6H10N2O4S3/c1-8-4-2-14(9,10)3-5(4)15(11,12)7-6(8)13/h4-5H,2-3H2,1H3,(H,7,13) |
| InChIKey | DLJSMXPNCRNUKQ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|