C9H7FN2O — CID 43831427
3-(2-fluorophenyl)-1,4-dihydropyrazol-5-one (PubChem CID 43831427) has the molecular formula C9H7FN2O and a molecular weight of 178.17 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,4-dihydropyrazol-5-one.
| Compound Name | 3-(2-fluorophenyl)-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 43831427 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-(2-fluorophenyl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(c2ccccc2F)=NN1 |
| InChI | InChI=1S/C9H7FN2O/c10-7-4-2-1-3-6(7)8-5-9(13)12-11-8/h1-4H,5H2,(H,12,13) |
| InChIKey | HOKMFFVGAIRDHC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |