C9H6FNO2 — CID 55276379
3-(2-fluorophenyl)-4H-1,2-oxazol-5-one (PubChem CID 55276379) has the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(2-fluorophenyl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 55276379 |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3-(2-fluorophenyl)-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(c2ccccc2F)=NO1 |
| InChI | InChI=1S/C9H6FNO2/c10-7-4-2-1-3-6(7)8-5-9(12)13-11-8/h1-4H,5H2 |
| InChIKey | YHLOFFMGJJNRIC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|