C11H11FN2 — CID 130252003
3-(2-fluorophenyl)-6-methyl-4,5-dihydropyridazine (PubChem CID 130252003) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-6-methyl-4,5-dihydropyridazine.
| Compound Name | 3-(2-fluorophenyl)-6-methyl-4,5-dihydropyridazine |
|---|---|
| PubChem CID | 130252003 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-(2-fluorophenyl)-6-methyl-4,5-dihydropyridazine |
| SMILES | CC1=NN=C(c2ccccc2F)CC1 |
| InChI | InChI=1S/C11H11FN2/c1-8-6-7-11(14-13-8)9-4-2-3-5-10(9)12/h2-5H,6-7H2,1H3 |
| InChIKey | TWOJMKRWOLMNDM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |