C22H20N2O3 — CID 43853807
(E)-3-(1,3-benzodioxol-5-yl)-N-(2,6,8-trimethylquinolin-4-yl)prop-2-enamide (PubChem CID 43853807) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(2,6,8-trimethylquinolin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,6,8-trimethylquinolin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 43853807 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,6,8-trimethylquinolin-4-yl)prop-2-enamide |
| SMILES | Cc1cc(C)c2nc(C)cc(NC(=O)/C=C/c3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C22H20N2O3/c1-13-8-14(2)22-17(9-13)18(10-15(3)23-22)24-21(25)7-5-16-4-6-19-20(11-16)27-12-26-19/h4-11H,12H2,1-3H3,(H,23,24,25)/b7-5+ |
| InChIKey | IIKBISUNXHSWAG-FNORWQNLSA-N |
| XLogP | 4.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|