C29H36N4O4 — CID 43855939
4-(4-butoxy-3-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43855939) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 4-(4-butoxy-3-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(4-butoxy-3-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43855939 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 4-(4-butoxy-3-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1ccc(C2c3c(-c4ccccc4)n[nH]c3C(=O)N2CCN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C29H36N4O4/c1-3-5-17-37-23-12-11-22(20-24(23)36-4-2)28-25-26(21-9-7-6-8-10-21)30-31-27(25)29(34)33(28)14-13-32-15-18-35-19-16-32/h6-12,20,28H,3-5,13-19H2,1-2H3,(H,30,31) |
| InChIKey | NGKMRIQYYKTFPA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|