C28H34N4O3 — CID 43856944
4-(3-butoxyphenyl)-3-(4-methylphenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43856944) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-(3-butoxyphenyl)-3-(4-methylphenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(3-butoxyphenyl)-3-(4-methylphenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43856944 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 4-(3-butoxyphenyl)-3-(4-methylphenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1cccc(C2c3c(-c4ccc(C)cc4)n[nH]c3C(=O)N2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C28H34N4O3/c1-3-4-16-35-23-7-5-6-22(19-23)27-24-25(21-10-8-20(2)9-11-21)29-30-26(24)28(33)32(27)13-12-31-14-17-34-18-15-31/h5-11,19,27H,3-4,12-18H2,1-2H3,(H,29,30) |
| InChIKey | IDLLUVWQYBGCAW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|