C27H31ClN4O3 — CID 43858030
4-(4-butoxyphenyl)-3-(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43858030) has the molecular formula C27H31ClN4O3 and a molecular weight of 495.02 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-3-(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(4-butoxyphenyl)-3-(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43858030 |
| Molecular Formula | C27H31ClN4O3 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 4-(4-butoxyphenyl)-3-(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1ccc(C2c3c(-c4ccc(Cl)cc4)n[nH]c3C(=O)N2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H31ClN4O3/c1-2-3-16-35-22-10-6-20(7-11-22)26-23-24(19-4-8-21(28)9-5-19)29-30-25(23)27(33)32(26)13-12-31-14-17-34-18-15-31/h4-11,26H,2-3,12-18H2,1H3,(H,29,30) |
| InChIKey | GBUUVJSNGIZRQX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|