C21H19N3O4S — CID 43859528
N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide (PubChem CID 43859528) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide.
| Compound Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 43859528 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide |
| SMILES | CC(=O)c1sc(NC(=O)c2ccc(N3C(=O)C4CC=CCC4C3=O)cc2)nc1C |
| InChI | InChI=1S/C21H19N3O4S/c1-11-17(12(2)25)29-21(22-11)23-18(26)13-7-9-14(10-8-13)24-19(27)15-5-3-4-6-16(15)20(24)28/h3-4,7-10,15-16H,5-6H2,1-2H3,(H,22,23,26) |
| InChIKey | ODAASYMFOMIJDQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|