C21H21N3O5 — CID 43860927
4-[2,5-dioxo-3-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]-2-hydroxybenzoic acid (PubChem CID 43860927) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-[2,5-dioxo-3-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[2,5-dioxo-3-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43860927 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[2,5-dioxo-3-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)CC(N3CCN(c4ccccc4)CC3)C2=O)cc1O |
| InChI | InChI=1S/C21H21N3O5/c25-18-12-15(6-7-16(18)21(28)29)24-19(26)13-17(20(24)27)23-10-8-22(9-11-23)14-4-2-1-3-5-14/h1-7,12,17,25H,8-11,13H2,(H,28,29) |
| InChIKey | DUEILYSMMKZIBZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|