C22H20N2O7S — CID 43861284
2-[[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid (PubChem CID 43861284) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43861284 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-[[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
| SMILES | CCC(Oc1ccc(/C=C2\S/C(=N/c3ccc(O)cc3C(=O)O)N(C)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C22H20N2O7S/c1-3-17(21(29)30)31-14-7-4-12(5-8-14)10-18-19(26)24(2)22(32-18)23-16-9-6-13(25)11-15(16)20(27)28/h4-11,17,25H,3H2,1-2H3,(H,27,28)(H,29,30)/b18-10-,23-22+ |
| InChIKey | PDBINIGDSQMFFQ-KAUGCCGLSA-N |
| XLogP | 3.57 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|