C23H18F2N2O7S2 — CID 43863653
2-[4-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]terephthalic acid (PubChem CID 43863653) has the molecular formula C23H18F2N2O7S2 and a molecular weight of 536.53 g/mol. Its IUPAC name is 2-[4-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]terephthalic acid.
| Compound Name | 2-[4-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]terephthalic acid |
|---|---|
| PubChem CID | 43863653 |
| Molecular Formula | C23H18F2N2O7S2 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 2-[4-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]terephthalic acid |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2ccccc2OC(F)F)SC1=S)Nc1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C23H18F2N2O7S2/c24-22(25)34-16-5-2-1-4-12(16)11-17-19(29)27(23(35)36-17)9-3-6-18(28)26-15-10-13(20(30)31)7-8-14(15)21(32)33/h1-2,4-5,7-8,10-11,22H,3,6,9H2,(H,26,28)(H,30,31)(H,32,33)/b17-11- |
| InChIKey | SRBJQABTBWBFAH-BOPFTXTBSA-N |
| XLogP | 4.30 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|