C22H17F2N3O3S3 — CID 4179695
N-(1,3-benzothiazol-2-yl)-4-[5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4179695) has the molecular formula C22H17F2N3O3S3 and a molecular weight of 505.59 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-[5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-[5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4179695 |
| Molecular Formula | C22H17F2N3O3S3 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-[5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2ccccc2OC(F)F)SC1=S)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H17F2N3O3S3/c23-20(24)30-15-8-3-1-6-13(15)12-17-19(29)27(22(31)33-17)11-5-10-18(28)26-21-25-14-7-2-4-9-16(14)32-21/h1-4,6-9,12,20H,5,10-11H2,(H,25,26,28) |
| InChIKey | QGCHJQALHOMSSM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|