C22H18F2N2O5S2 — CID 27426258
2-[3-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl-methylamino]benzoic acid (PubChem CID 27426258) has the molecular formula C22H18F2N2O5S2 and a molecular weight of 492.53 g/mol. Its IUPAC name is 2-[3-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl-methylamino]benzoic acid.
| Compound Name | 2-[3-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 27426258 |
| Molecular Formula | C22H18F2N2O5S2 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-[3-[(5Z)-5-[[2-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl-methylamino]benzoic acid |
| SMILES | CN(C(=O)CCN1C(=O)/C(=C/c2ccccc2OC(F)F)SC1=S)c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H18F2N2O5S2/c1-25(15-8-4-3-7-14(15)20(29)30)18(27)10-11-26-19(28)17(33-22(26)32)12-13-6-2-5-9-16(13)31-21(23)24/h2-9,12,21H,10-11H2,1H3,(H,29,30)/b17-12- |
| InChIKey | TVADWWYQCCPQIN-ATVHPVEESA-N |
| XLogP | 4.24 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|