C21H16N6O — CID 43864841
5-methyl-8-phenyl-11-(pyridin-3-ylmethyl)-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one (PubChem CID 43864841) has the molecular formula C21H16N6O and a molecular weight of 368.40 g/mol. Its IUPAC name is 5-methyl-8-phenyl-11-(pyridin-3-ylmethyl)-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one.
| Compound Name | 5-methyl-8-phenyl-11-(pyridin-3-ylmethyl)-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 43864841 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-methyl-8-phenyl-11-(pyridin-3-ylmethyl)-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
| SMILES | Cc1nc2nc3ccn(Cc4cccnc4)c(=O)c3c(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C21H16N6O/c1-14-23-21-24-17-9-11-26(13-15-6-5-10-22-12-15)20(28)18(17)19(27(21)25-14)16-7-3-2-4-8-16/h2-12H,13H2,1H3 |
| InChIKey | LFGLALQIRAJZLY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |