C22H20N4O4 — CID 43865190
N-[4-[8-(2-methoxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]phenyl]acetamide (PubChem CID 43865190) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[4-[8-(2-methoxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[8-(2-methoxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 43865190 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[4-[8-(2-methoxyethyl)-1,9-dioxopyrido[4,3-b][1,6]naphthyridin-2-yl]phenyl]acetamide |
| SMILES | COCCn1ccc2nc3ccn(-c4ccc(NC(C)=O)cc4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H20N4O4/c1-14(27)23-15-3-5-16(6-4-15)26-10-8-20-18(22(26)29)13-17-19(24-20)7-9-25(21(17)28)11-12-30-2/h3-10,13H,11-12H2,1-2H3,(H,23,27) |
| InChIKey | ZFZBJIHETMBDOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|