C17H17ClF2N2O4S — CID 43872761
2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3,4-difluorophenyl)propanamide (PubChem CID 43872761) has the molecular formula C17H17ClF2N2O4S and a molecular weight of 418.85 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 43872761 |
| Molecular Formula | C17H17ClF2N2O4S |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3,4-difluorophenyl)propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(C)C(=O)Nc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C17H17ClF2N2O4S/c1-3-26-16-7-5-12(9-13(16)18)27(24,25)22-10(2)17(23)21-11-4-6-14(19)15(20)8-11/h4-10,22H,3H2,1-2H3,(H,21,23) |
| InChIKey | YIYOLRANUUHXAV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |