C25H23F3N2O3 — CID 43878204
3-[2-(4-methylphenoxy)butanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 43878204) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is 3-[2-(4-methylphenoxy)butanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-(4-methylphenoxy)butanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43878204 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[2-(4-methylphenoxy)butanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCC(Oc1ccc(C)cc1)C(=O)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H23F3N2O3/c1-3-22(33-21-12-10-16(2)11-13-21)24(32)30-19-8-4-6-17(14-19)23(31)29-20-9-5-7-18(15-20)25(26,27)28/h4-15,22H,3H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | KEWVSQMEONUTIR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |