C30H29N3O6S — CID 43891746
N,N-dibenzyl-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 43891746) has the molecular formula C30H29N3O6S and a molecular weight of 559.64 g/mol. Its IUPAC name is N,N-dibenzyl-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43891746 |
| Molecular Formula | C30H29N3O6S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | N,N-dibenzyl-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccccc2)Cc2ccccc2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H29N3O6S/c1-23-13-18-28(19-29(23)33(35)36)40(37,38)32(26-14-16-27(39-2)17-15-26)22-30(34)31(20-24-9-5-3-6-10-24)21-25-11-7-4-8-12-25/h3-19H,20-22H2,1-2H3 |
| InChIKey | UDLAEYUPSYKIEN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|