C26H28Cl2N2O4S — CID 43893372
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(2-propoxyphenyl)propyl]acetamide (PubChem CID 43893372) has the molecular formula C26H28Cl2N2O4S and a molecular weight of 535.49 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(2-propoxyphenyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(2-propoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43893372 |
| Molecular Formula | C26H28Cl2N2O4S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(2-propoxyphenyl)propyl]acetamide |
| SMILES | CCCOc1ccccc1CCCNC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28Cl2N2O4S/c1-2-17-34-25-13-7-6-9-20(25)10-8-16-29-26(31)19-30(24-15-14-21(27)18-23(24)28)35(32,33)22-11-4-3-5-12-22/h3-7,9,11-15,18H,2,8,10,16-17,19H2,1H3,(H,29,31) |
| InChIKey | DEEZAEHEGDDFBT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|