C28H30ClN3O7S — CID 43898059
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide (PubChem CID 43898059) has the molecular formula C28H30ClN3O7S and a molecular weight of 588.08 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 43898059 |
| Molecular Formula | C28H30ClN3O7S |
| Molecular Weight | 588.08 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NC1CC(C)(C)Oc2ccc(C)cc21)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H30ClN3O7S/c1-17-6-10-25-21(12-17)22(15-28(3,4)39-25)30-27(33)16-31(24-13-19(29)8-11-26(24)38-5)40(36,37)20-9-7-18(2)23(14-20)32(34)35/h6-14,22H,15-16H2,1-5H3,(H,30,33) |
| InChIKey | XZOASQONEPRKNP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.08 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|