C27H33N5O6S — CID 43914650
ethyl 5-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]carbamothioylamino]-2-morpholin-4-ylbenzoate (PubChem CID 43914650) has the molecular formula C27H33N5O6S and a molecular weight of 555.66 g/mol. Its IUPAC name is ethyl 5-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]carbamothioylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | ethyl 5-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]carbamothioylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 43914650 |
| Molecular Formula | C27H33N5O6S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | ethyl 5-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]carbamothioylamino]-2-morpholin-4-ylbenzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NC(=O)c2ccc(N3CCC(C)CC3)c([N+](=O)[O-])c2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H33N5O6S/c1-3-38-26(34)21-17-20(5-7-22(21)31-12-14-37-15-13-31)28-27(39)29-25(33)19-4-6-23(24(16-19)32(35)36)30-10-8-18(2)9-11-30/h4-7,16-18H,3,8-15H2,1-2H3,(H2,28,29,33,39) |
| InChIKey | CFVHBWOWXXLMIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|