C20H20ClF3N2O — CID 43919998
1-[(2-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide (PubChem CID 43919998) has the molecular formula C20H20ClF3N2O and a molecular weight of 396.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43919998 |
| Molecular Formula | C20H20ClF3N2O |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H20ClF3N2O/c21-18-9-2-1-5-14(18)12-26-10-4-6-15(13-26)19(27)25-17-8-3-7-16(11-17)20(22,23)24/h1-3,5,7-9,11,15H,4,6,10,12-13H2,(H,25,27) |
| InChIKey | WLQUECISZADRKY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |