C22H30N2O3S — CID 43922720
1-[(3-ethoxyphenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 43922720) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-[(3-ethoxyphenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-ethoxyphenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43922720 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-[(3-ethoxyphenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCOc1cccc(CN2CCC(C(=O)NCCSCc3ccco3)CC2)c1 |
| InChI | InChI=1S/C22H30N2O3S/c1-2-26-20-6-3-5-18(15-20)16-24-11-8-19(9-12-24)22(25)23-10-14-28-17-21-7-4-13-27-21/h3-7,13,15,19H,2,8-12,14,16-17H2,1H3,(H,23,25) |
| InChIKey | MTABAUGPYPJVPI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|