C26H26Cl2N2O — CID 43925892
N-benzhydryl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43925892) has the molecular formula C26H26Cl2N2O and a molecular weight of 453.41 g/mol. Its IUPAC name is N-benzhydryl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-benzhydryl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43925892 |
| Molecular Formula | C26H26Cl2N2O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-benzhydryl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C1CCCN(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C26H26Cl2N2O/c27-23-14-13-21(24(28)16-23)17-30-15-7-12-22(18-30)26(31)29-25(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-14,16,22,25H,7,12,15,17-18H2,(H,29,31) |
| InChIKey | BLOGMKXNBNISKZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |