C16H14ClN5O4 — CID 43935935
ethyl 2-[3-(4-chlorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate (PubChem CID 43935935) has the molecular formula C16H14ClN5O4 and a molecular weight of 375.77 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 43935935 |
| Molecular Formula | C16H14ClN5O4 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)n1cnc2c(nnn2-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C16H14ClN5O4/c1-3-26-16(25)13(9(2)23)21-8-18-14-12(15(21)24)19-20-22(14)11-6-4-10(17)5-7-11/h4-8,13H,3H2,1-2H3 |
| InChIKey | NDXWSYLGKCCKIR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|