C15H12BrN5O3 — CID 7476125
3-[3-(4-bromophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]pentane-2,4-dione (PubChem CID 7476125) has the molecular formula C15H12BrN5O3 and a molecular weight of 390.20 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]pentane-2,4-dione.
| Compound Name | 3-[3-(4-bromophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 7476125 |
| Molecular Formula | C15H12BrN5O3 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 3-[3-(4-bromophenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)n1cnc2c(nnn2-c2ccc(Br)cc2)c1=O |
| InChI | InChI=1S/C15H12BrN5O3/c1-8(22)13(9(2)23)20-7-17-14-12(15(20)24)18-19-21(14)11-5-3-10(16)4-6-11/h3-7,13H,1-2H3 |
| InChIKey | VHVMGZQSVMFETG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|