C18H19N5O4 — CID 7476534
ethyl (2R)-2-[3-(3,5-dimethylphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate (PubChem CID 7476534) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl (2R)-2-[3-(3,5-dimethylphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[3-(3,5-dimethylphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7476534 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl (2R)-2-[3-(3,5-dimethylphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C(C)=O)n1cnc2c(nnn2-c2cc(C)cc(C)c2)c1=O |
| InChI | InChI=1S/C18H19N5O4/c1-5-27-18(26)15(12(4)24)22-9-19-16-14(17(22)25)20-21-23(16)13-7-10(2)6-11(3)8-13/h6-9,15H,5H2,1-4H3/t15-/m1/s1 |
| InChIKey | WBWIPKPFCHNLAB-OAHLLOKOSA-N |
| XLogP | 1.29 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|