C22H15ClFN3OS — CID 43936813
N-(3-chloro-4-fluorophenyl)-2-(6-naphthalen-2-ylpyridazin-3-yl)sulfanylacetamide (PubChem CID 43936813) has the molecular formula C22H15ClFN3OS and a molecular weight of 423.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(6-naphthalen-2-ylpyridazin-3-yl)sulfanylacetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(6-naphthalen-2-ylpyridazin-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 43936813 |
| Molecular Formula | C22H15ClFN3OS |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(6-naphthalen-2-ylpyridazin-3-yl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(-c2ccc3ccccc3c2)nn1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H15ClFN3OS/c23-18-12-17(7-8-19(18)24)25-21(28)13-29-22-10-9-20(26-27-22)16-6-5-14-3-1-2-4-15(14)11-16/h1-12H,13H2,(H,25,28) |
| InChIKey | SITHYXPIDNBLQL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |