C16H12BrClFN3O2 — CID 43948408
N-[2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-chloro-6-fluorobenzamide (PubChem CID 43948408) has the molecular formula C16H12BrClFN3O2 and a molecular weight of 412.65 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 43948408 |
| Molecular Formula | C16H12BrClFN3O2 |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | N-[2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-chloro-6-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1c(F)cccc1Cl)N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrClFN3O2/c17-11-6-4-10(5-7-11)8-21-22-14(23)9-20-16(24)15-12(18)2-1-3-13(15)19/h1-8H,9H2,(H,20,24)(H,22,23)/b21-8+ |
| InChIKey | VUAHOERYIKAZDY-ODCIPOBUSA-N |
| XLogP | 3.12 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|