C10H17N3OS — CID 43949596
3-ethoxy-4-(2-methylpiperidin-1-yl)-1,2,5-thiadiazole (PubChem CID 43949596) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-ethoxy-4-(2-methylpiperidin-1-yl)-1,2,5-thiadiazole.
| Compound Name | 3-ethoxy-4-(2-methylpiperidin-1-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43949596 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-ethoxy-4-(2-methylpiperidin-1-yl)-1,2,5-thiadiazole |
| SMILES | CCOc1nsnc1N1CCCCC1C |
| InChI | InChI=1S/C10H17N3OS/c1-3-14-10-9(11-15-12-10)13-7-5-4-6-8(13)2/h8H,3-7H2,1-2H3 |
| InChIKey | ZWIWTVFUYOXOIF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |