C16H19N3O3 — CID 97177738
(2R)-1-(3-ethoxyquinoxalin-2-yl)piperidine-2-carboxylic acid (PubChem CID 97177738) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2R)-1-(3-ethoxyquinoxalin-2-yl)piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3-ethoxyquinoxalin-2-yl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 97177738 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2R)-1-(3-ethoxyquinoxalin-2-yl)piperidine-2-carboxylic acid |
| SMILES | CCOc1nc2ccccc2nc1N1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H19N3O3/c1-2-22-15-14(17-11-7-3-4-8-12(11)18-15)19-10-6-5-9-13(19)16(20)21/h3-4,7-8,13H,2,5-6,9-10H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | IDDSFRDMRBQTFZ-CYBMUJFWSA-N |
| XLogP | 2.47 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |