C15H18N4O3S — CID 43949619
3-(2-methylpiperidin-1-yl)-4-[(4-nitrophenyl)methoxy]-1,2,5-thiadiazole (PubChem CID 43949619) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)-4-[(4-nitrophenyl)methoxy]-1,2,5-thiadiazole.
| Compound Name | 3-(2-methylpiperidin-1-yl)-4-[(4-nitrophenyl)methoxy]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43949619 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)-4-[(4-nitrophenyl)methoxy]-1,2,5-thiadiazole |
| SMILES | CC1CCCCN1c1nsnc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-11-4-2-3-9-18(11)14-15(17-23-16-14)22-10-12-5-7-13(8-6-12)19(20)21/h5-8,11H,2-4,9-10H2,1H3 |
| InChIKey | JURBJFYBQCVVGT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|