C20H26N4O5S — CID 43952528
methyl 2-[(2,6-dimethoxypyrimidine-4-carbonyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 43952528) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is methyl 2-[(2,6-dimethoxypyrimidine-4-carbonyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(2,6-dimethoxypyrimidine-4-carbonyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43952528 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | methyl 2-[(2,6-dimethoxypyrimidine-4-carbonyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc(OC)nc(OC)n2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C20H26N4O5S/c1-19(2)9-10-13(17(26)28-6)16(30-14(10)20(3,4)24-19)23-15(25)11-8-12(27-5)22-18(21-11)29-7/h8,24H,9H2,1-7H3,(H,23,25) |
| InChIKey | IGJSNGHWSXBHHT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |