C18H20N4O2S — CID 43953257
4-(dimethylamino)-N'-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 43953257) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(dimethylamino)-N'-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 4-(dimethylamino)-N'-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 43953257 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-(dimethylamino)-N'-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | COc1ccc(C)c2sc(NNC(=O)c3ccc(N(C)C)cc3)nc12 |
| InChI | InChI=1S/C18H20N4O2S/c1-11-5-10-14(24-4)15-16(11)25-18(19-15)21-20-17(23)12-6-8-13(9-7-12)22(2)3/h5-10H,1-4H3,(H,19,21)(H,20,23) |
| InChIKey | LGHBQERQCYAZBQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|